C10H15F2O3P — CID 11975165
(3-cyclopentylidene-1,1-difluoroprop-2-enyl)-ethoxyphosphinic acid (PubChem CID 11975165) has the molecular formula C10H15F2O3P and a molecular weight of 252.20 g/mol. Its IUPAC name is (3-cyclopentylidene-1,1-difluoroprop-2-enyl)-ethoxyphosphinic acid.
| Compound Name | (3-cyclopentylidene-1,1-difluoroprop-2-enyl)-ethoxyphosphinic acid |
|---|---|
| PubChem CID | 11975165 |
| Molecular Formula | C10H15F2O3P |
| Molecular Weight | 252.20 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | (3-cyclopentylidene-1,1-difluoroprop-2-enyl)-ethoxyphosphinic acid |
| SMILES | CCOP(=O)(O)C(F)(F)C=C=C1CCCC1 |
| InChI | InChI=1S/C10H15F2O3P/c1-2-15-16(13,14)10(11,12)8-7-9-5-3-4-6-9/h8H,2-6H2,1H3,(H,13,14) |
| InChIKey | BQCQNQLOOZMBBB-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.20 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|