C9H15F2O3P — CID 11975163
(1,1-difluoro-5-methylhexa-2,3-dienyl)-ethoxyphosphinic acid (PubChem CID 11975163) has the molecular formula C9H15F2O3P and a molecular weight of 240.19 g/mol. Its IUPAC name is (1,1-difluoro-5-methylhexa-2,3-dienyl)-ethoxyphosphinic acid.
| Compound Name | (1,1-difluoro-5-methylhexa-2,3-dienyl)-ethoxyphosphinic acid |
|---|---|
| PubChem CID | 11975163 |
| Molecular Formula | C9H15F2O3P |
| Molecular Weight | 240.19 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | (1,1-difluoro-5-methylhexa-2,3-dienyl)-ethoxyphosphinic acid |
| SMILES | CCOP(=O)(O)C(F)(F)C=C=CC(C)C |
| InChI | InChI=1S/C9H15F2O3P/c1-4-14-15(12,13)9(10,11)7-5-6-8(2)3/h6-8H,4H2,1-3H3,(H,12,13) |
| InChIKey | ZIZMVKKMQHWWST-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.19 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|