C8H13F2O3P — CID 14268064
4-diethoxyphosphoryl-4,4-difluorobuta-1,2-diene (PubChem CID 14268064) has the molecular formula C8H13F2O3P and a molecular weight of 226.16 g/mol. Its IUPAC name is 4-diethoxyphosphoryl-4,4-difluorobuta-1,2-diene.
| Compound Name | 4-diethoxyphosphoryl-4,4-difluorobuta-1,2-diene |
|---|---|
| PubChem CID | 14268064 |
| Molecular Formula | C8H13F2O3P |
| Molecular Weight | 226.16 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 4-diethoxyphosphoryl-4,4-difluorobuta-1,2-diene |
| SMILES | C=C=CC(F)(F)P(=O)(OCC)OCC |
| InChI | InChI=1S/C8H13F2O3P/c1-4-7-8(9,10)14(11,12-5-2)13-6-3/h7H,1,5-6H2,2-3H3 |
| InChIKey | GXBHQTBXMMOUHU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.16 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|