C8H13F2O3P — CID 76764487
(1,1-difluoro-4-methylpenta-2,3-dienyl)-ethoxyphosphinic acid (PubChem CID 76764487) has the molecular formula C8H13F2O3P and a molecular weight of 226.16 g/mol. Its IUPAC name is (1,1-difluoro-4-methylpenta-2,3-dienyl)-ethoxyphosphinic acid.
| Compound Name | (1,1-difluoro-4-methylpenta-2,3-dienyl)-ethoxyphosphinic acid |
|---|---|
| PubChem CID | 76764487 |
| Molecular Formula | C8H13F2O3P |
| Molecular Weight | 226.16 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | (1,1-difluoro-4-methylpenta-2,3-dienyl)-ethoxyphosphinic acid |
| SMILES | CCOP(=O)(O)C(F)(F)C=C=C(C)C |
| InChI | InChI=1S/C8H13F2O3P/c1-4-13-14(11,12)8(9,10)6-5-7(2)3/h6H,4H2,1-3H3,(H,11,12) |
| InChIKey | YCQPNBPNDCJGNX-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.16 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|