C9H16F3O3P — CID 11821329
(E)-4-diethoxyphosphoryl-1,1,1-trifluoro-2-methylbut-2-ene (PubChem CID 11821329) has the molecular formula C9H16F3O3P and a molecular weight of 260.19 g/mol. Its IUPAC name is (E)-4-diethoxyphosphoryl-1,1,1-trifluoro-2-methylbut-2-ene.
| Compound Name | (E)-4-diethoxyphosphoryl-1,1,1-trifluoro-2-methylbut-2-ene |
|---|---|
| PubChem CID | 11821329 |
| Molecular Formula | C9H16F3O3P |
| Molecular Weight | 260.19 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | (E)-4-diethoxyphosphoryl-1,1,1-trifluoro-2-methylbut-2-ene |
| SMILES | CCOP(=O)(C/C=C(\C)C(F)(F)F)OCC |
| InChI | InChI=1S/C9H16F3O3P/c1-4-14-16(13,15-5-2)7-6-8(3)9(10,11)12/h6H,4-5,7H2,1-3H3/b8-6+ |
| InChIKey | HCZJBLIQKIUZHY-SOFGYWHQSA-N |
| XLogP | 3.76 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.19 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|