C9H11F8O3P — CID 100985718
(E)-1-diethoxyphosphoryl-1,1,4,4,4-pentafluoro-2-(trifluoromethyl)but-2-ene (PubChem CID 100985718) has the molecular formula C9H11F8O3P and a molecular weight of 350.14 g/mol. Its IUPAC name is (E)-1-diethoxyphosphoryl-1,1,4,4,4-pentafluoro-2-(trifluoromethyl)but-2-ene.
| Compound Name | (E)-1-diethoxyphosphoryl-1,1,4,4,4-pentafluoro-2-(trifluoromethyl)but-2-ene |
|---|---|
| PubChem CID | 100985718 |
| Molecular Formula | C9H11F8O3P |
| Molecular Weight | 350.14 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | (E)-1-diethoxyphosphoryl-1,1,4,4,4-pentafluoro-2-(trifluoromethyl)but-2-ene |
| SMILES | CCOP(=O)(OCC)C(F)(F)/C(=C/C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H11F8O3P/c1-3-19-21(18,20-4-2)9(16,17)6(8(13,14)15)5-7(10,11)12/h5H,3-4H2,1-2H3/b6-5+ |
| InChIKey | YFDQBBHFNMMEPI-AATRIKPKSA-N |
| XLogP | 4.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.14 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|