C9H13F6O3P — CID 11066985
(Z)-1-[bis(2,2,2-trifluoroethoxy)phosphoryl]-3-methylbut-1-ene (PubChem CID 11066985) has the molecular formula C9H13F6O3P and a molecular weight of 314.16 g/mol. Its IUPAC name is (Z)-1-[bis(2,2,2-trifluoroethoxy)phosphoryl]-3-methylbut-1-ene.
| Compound Name | (Z)-1-[bis(2,2,2-trifluoroethoxy)phosphoryl]-3-methylbut-1-ene |
|---|---|
| PubChem CID | 11066985 |
| Molecular Formula | C9H13F6O3P |
| Molecular Weight | 314.16 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | (Z)-1-[bis(2,2,2-trifluoroethoxy)phosphoryl]-3-methylbut-1-ene |
| SMILES | CC(C)/C=C\P(=O)(OCC(F)(F)F)OCC(F)(F)F |
| InChI | InChI=1S/C9H13F6O3P/c1-7(2)3-4-19(16,17-5-8(10,11)12)18-6-9(13,14)15/h3-4,7H,5-6H2,1-2H3/b4-3- |
| InChIKey | XZUKDCBWSRFKMM-ARJAWSKDSA-N |
| XLogP | 4.51 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.16 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|