C10H16F3O3P — CID 90706509
4-[but-3-enoxy(2,2,2-trifluoroethyl)phosphoryl]oxybut-1-ene (PubChem CID 90706509) has the molecular formula C10H16F3O3P and a molecular weight of 272.20 g/mol. Its IUPAC name is 4-[but-3-enoxy(2,2,2-trifluoroethyl)phosphoryl]oxybut-1-ene.
| Compound Name | 4-[but-3-enoxy(2,2,2-trifluoroethyl)phosphoryl]oxybut-1-ene |
|---|---|
| PubChem CID | 90706509 |
| Molecular Formula | C10H16F3O3P |
| Molecular Weight | 272.20 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 4-[but-3-enoxy(2,2,2-trifluoroethyl)phosphoryl]oxybut-1-ene |
| SMILES | C=CCCOP(=O)(CC(F)(F)F)OCCC=C |
| InChI | InChI=1S/C10H16F3O3P/c1-3-5-7-15-17(14,9-10(11,12)13)16-8-6-4-2/h3-4H,1-2,5-9H2 |
| InChIKey | WXXVGASSNVROKH-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.20 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|