C9H15F2O3P — CID 101098287
1-diethoxyphosphoryl-1,1-difluoropenta-2,3-diene (PubChem CID 101098287) has the molecular formula C9H15F2O3P and a molecular weight of 240.19 g/mol. Its IUPAC name is 1-diethoxyphosphoryl-1,1-difluoropenta-2,3-diene.
| Compound Name | 1-diethoxyphosphoryl-1,1-difluoropenta-2,3-diene |
|---|---|
| PubChem CID | 101098287 |
| Molecular Formula | C9H15F2O3P |
| Molecular Weight | 240.19 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 1-diethoxyphosphoryl-1,1-difluoropenta-2,3-diene |
| SMILES | CC=C=CC(F)(F)P(=O)(OCC)OCC |
| InChI | InChI=1S/C9H15F2O3P/c1-4-7-8-9(10,11)15(12,13-5-2)14-6-3/h4,8H,5-6H2,1-3H3 |
| InChIKey | GOLBXCCGVAXSQV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.19 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|