C19H38F3O3PSn — CID 134974432
tributyl-[(Z)-1-diethoxyphosphoryl-3,3,3-trifluoroprop-1-enyl]stannane (PubChem CID 134974432) has the molecular formula C19H38F3O3PSn and a molecular weight of 521.19 g/mol. Its IUPAC name is tributyl-[(Z)-1-diethoxyphosphoryl-3,3,3-trifluoroprop-1-enyl]stannane.
| Compound Name | tributyl-[(Z)-1-diethoxyphosphoryl-3,3,3-trifluoroprop-1-enyl]stannane |
|---|---|
| PubChem CID | 134974432 |
| Molecular Formula | C19H38F3O3PSn |
| Molecular Weight | 521.19 g/mol |
| Exact Mass | 522.15 |
| IUPAC Name | tributyl-[(Z)-1-diethoxyphosphoryl-3,3,3-trifluoroprop-1-enyl]stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)/C(=C\C(F)(F)F)P(=O)(OCC)OCC |
| InChI | InChI=1S/C7H11F3O3P.3C4H9.Sn/c1-3-12-14(11,13-4-2)6-5-7(8,9)10;3*1-3-4-2;/h5H,3-4H2,1-2H3;3*1,3-4H2,2H3; |
| InChIKey | HHKPXEZZRAFCMW-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.19 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|