C31H64F3O3PSn2 — CID 44519094
tributyl-[(E)-1-diethoxyphosphoryl-3,3,3-trifluoro-1-tributylstannylprop-1-en-2-yl]stannane (PubChem CID 44519094) has the molecular formula C31H64F3O3PSn2 and a molecular weight of 810.24 g/mol. Its IUPAC name is tributyl-[(E)-1-diethoxyphosphoryl-3,3,3-trifluoro-1-tributylstannylprop-1-en-2-yl]stannane.
| Compound Name | tributyl-[(E)-1-diethoxyphosphoryl-3,3,3-trifluoro-1-tributylstannylprop-1-en-2-yl]stannane |
|---|---|
| PubChem CID | 44519094 |
| Molecular Formula | C31H64F3O3PSn2 |
| Molecular Weight | 810.24 g/mol |
| Exact Mass | 812.26 |
| IUPAC Name | tributyl-[(E)-1-diethoxyphosphoryl-3,3,3-trifluoro-1-tributylstannylprop-1-en-2-yl]stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)/C(=C(\P(=O)(OCC)OCC)[Sn](CCCC)(CCCC)CCCC)C(F)(F)F |
| InChI | InChI=1S/C7H10F3O3P.6C4H9.2Sn/c1-3-12-14(11,13-4-2)6-5-7(8,9)10;6*1-3-4-2;;/h3-4H2,1-2H3;6*1,3-4H2,2H3;; |
| InChIKey | KDQYAUFFOQOQOQ-UHFFFAOYSA-N |
| XLogP | 12.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.24 |
| LogP ≤ 5 | 12.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|