C31H65F2O3PSn2 — CID 44518589
tributyl-[(E)-1-diethoxyphosphoryl-3,3-difluoro-1-tributylstannylprop-1-en-2-yl]stannane (PubChem CID 44518589) has the molecular formula C31H65F2O3PSn2 and a molecular weight of 792.25 g/mol. Its IUPAC name is tributyl-[(E)-1-diethoxyphosphoryl-3,3-difluoro-1-tributylstannylprop-1-en-2-yl]stannane.
| Compound Name | tributyl-[(E)-1-diethoxyphosphoryl-3,3-difluoro-1-tributylstannylprop-1-en-2-yl]stannane |
|---|---|
| PubChem CID | 44518589 |
| Molecular Formula | C31H65F2O3PSn2 |
| Molecular Weight | 792.25 g/mol |
| Exact Mass | 794.27 |
| IUPAC Name | tributyl-[(E)-1-diethoxyphosphoryl-3,3-difluoro-1-tributylstannylprop-1-en-2-yl]stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)/C(=C(\P(=O)(OCC)OCC)[Sn](CCCC)(CCCC)CCCC)C(F)F |
| InChI | InChI=1S/C7H11F2O3P.6C4H9.2Sn/c1-3-11-13(10,12-4-2)6-5-7(8)9;6*1-3-4-2;;/h7H,3-4H2,1-2H3;6*1,3-4H2,2H3;; |
| InChIKey | ZMORXSQXUVSSEU-UHFFFAOYSA-N |
| XLogP | 12.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.25 |
| LogP ≤ 5 | 12.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|