C12H19F2O3P — CID 102254199
(3-diethoxyphosphoryl-3,3-difluoroprop-1-enylidene)cyclopentane (PubChem CID 102254199) has the molecular formula C12H19F2O3P and a molecular weight of 280.25 g/mol. Its IUPAC name is (3-diethoxyphosphoryl-3,3-difluoroprop-1-enylidene)cyclopentane.
| Compound Name | (3-diethoxyphosphoryl-3,3-difluoroprop-1-enylidene)cyclopentane |
|---|---|
| PubChem CID | 102254199 |
| Molecular Formula | C12H19F2O3P |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | (3-diethoxyphosphoryl-3,3-difluoroprop-1-enylidene)cyclopentane |
| SMILES | CCOP(=O)(OCC)C(F)(F)C=C=C1CCCC1 |
| InChI | InChI=1S/C12H19F2O3P/c1-3-16-18(15,17-4-2)12(13,14)10-9-11-7-5-6-8-11/h10H,3-8H2,1-2H3 |
| InChIKey | RKKWDCLMRMHUSI-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|