C11H19F2O3P — CID 101098289
1-diethoxyphosphoryl-1,1-difluorohepta-2,3-diene (PubChem CID 101098289) has the molecular formula C11H19F2O3P and a molecular weight of 268.24 g/mol. Its IUPAC name is 1-diethoxyphosphoryl-1,1-difluorohepta-2,3-diene.
| Compound Name | 1-diethoxyphosphoryl-1,1-difluorohepta-2,3-diene |
|---|---|
| PubChem CID | 101098289 |
| Molecular Formula | C11H19F2O3P |
| Molecular Weight | 268.24 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 1-diethoxyphosphoryl-1,1-difluorohepta-2,3-diene |
| SMILES | CCCC=C=CC(F)(F)P(=O)(OCC)OCC |
| InChI | InChI=1S/C11H19F2O3P/c1-4-7-8-9-10-11(12,13)17(14,15-5-2)16-6-3/h8,10H,4-7H2,1-3H3 |
| InChIKey | YKJSDUBOVAXNEL-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.24 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|