C10H17F2O3P — CID 15418135
1-[diethoxyphosphoryl(difluoro)methyl]cyclopentene (PubChem CID 15418135) has the molecular formula C10H17F2O3P and a molecular weight of 254.21 g/mol. Its IUPAC name is 1-[diethoxyphosphoryl(difluoro)methyl]cyclopentene.
| Compound Name | 1-[diethoxyphosphoryl(difluoro)methyl]cyclopentene |
|---|---|
| PubChem CID | 15418135 |
| Molecular Formula | C10H17F2O3P |
| Molecular Weight | 254.21 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 1-[diethoxyphosphoryl(difluoro)methyl]cyclopentene |
| SMILES | CCOP(=O)(OCC)C(F)(F)C1=CCCC1 |
| InChI | InChI=1S/C10H17F2O3P/c1-3-14-16(13,15-4-2)10(11,12)9-7-5-6-8-9/h7H,3-6,8H2,1-2H3 |
| InChIKey | PCGOUOGKZQHLAK-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.21 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|