C11H16F3O2P — CID 171093017
ethoxy-methoxy-[[4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]methyl]phosphane (PubChem CID 171093017) has the molecular formula C11H16F3O2P and a molecular weight of 268.21 g/mol. Its IUPAC name is ethoxy-methoxy-[[4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]methyl]phosphane.
| Compound Name | ethoxy-methoxy-[[4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]methyl]phosphane |
|---|---|
| PubChem CID | 171093017 |
| Molecular Formula | C11H16F3O2P |
| Molecular Weight | 268.21 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | ethoxy-methoxy-[[4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]methyl]phosphane |
| SMILES | CCOP(CC1=CC=C(C(F)(F)F)CC1)OC |
| InChI | InChI=1S/C11H16F3O2P/c1-3-16-17(15-2)8-9-4-6-10(7-5-9)11(12,13)14/h4,6H,3,5,7-8H2,1-2H3 |
| InChIKey | GYZZNTQOXFIBJW-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.21 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|