C12H18F3O2P — CID 171093068
diethoxy-[[4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]methyl]phosphane (PubChem CID 171093068) has the molecular formula C12H18F3O2P and a molecular weight of 282.24 g/mol. Its IUPAC name is diethoxy-[[4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]methyl]phosphane.
| Compound Name | diethoxy-[[4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]methyl]phosphane |
|---|---|
| PubChem CID | 171093068 |
| Molecular Formula | C12H18F3O2P |
| Molecular Weight | 282.24 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | diethoxy-[[4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]methyl]phosphane |
| SMILES | CCOP(CC1=CC=C(C(F)(F)F)CC1)OCC |
| InChI | InChI=1S/C12H18F3O2P/c1-3-16-18(17-4-2)9-10-5-7-11(8-6-10)12(13,14)15/h5,7H,3-4,6,8-9H2,1-2H3 |
| InChIKey | NFZSCCBBEICUBV-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.24 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|