C13H21F2O3P — CID 11403641
(3-diethoxyphosphoryl-3,3-difluoroprop-1-enylidene)cyclohexane (PubChem CID 11403641) has the molecular formula C13H21F2O3P and a molecular weight of 294.28 g/mol. Its IUPAC name is (3-diethoxyphosphoryl-3,3-difluoroprop-1-enylidene)cyclohexane.
| Compound Name | (3-diethoxyphosphoryl-3,3-difluoroprop-1-enylidene)cyclohexane |
|---|---|
| PubChem CID | 11403641 |
| Molecular Formula | C13H21F2O3P |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | (3-diethoxyphosphoryl-3,3-difluoroprop-1-enylidene)cyclohexane |
| SMILES | CCOP(=O)(OCC)C(F)(F)C=C=C1CCCCC1 |
| InChI | InChI=1S/C13H21F2O3P/c1-3-17-19(16,18-4-2)13(14,15)11-10-12-8-6-5-7-9-12/h11H,3-9H2,1-2H3 |
| InChIKey | IMTKOHRKMACXKB-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|