C18H31LiO6P2 — CID 15888833
lithium 1-tert-butyl-3,5-bis(diethoxyphosphoryl)benzene-4-ide (PubChem CID 15888833) has the molecular formula C18H31LiO6P2 and a molecular weight of 412.33 g/mol. Its IUPAC name is lithium 1-tert-butyl-3,5-bis(diethoxyphosphoryl)benzene-4-ide.
| Compound Name | lithium 1-tert-butyl-3,5-bis(diethoxyphosphoryl)benzene-4-ide |
|---|---|
| PubChem CID | 15888833 |
| Molecular Formula | C18H31LiO6P2 |
| Molecular Weight | 412.33 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | lithium 1-tert-butyl-3,5-bis(diethoxyphosphoryl)benzene-4-ide |
| SMILES | CCOP(=O)(OCC)c1[c-]c(P(=O)(OCC)OCC)cc(C(C)(C)C)c1.[Li+] |
| InChI | InChI=1S/C18H31O6P2.Li/c1-8-21-25(19,22-9-2)16-12-15(18(5,6)7)13-17(14-16)26(20,23-10-3)24-11-4;/h12-13H,8-11H2,1-7H3;/q-1;+1 |
| InChIKey | GICROIQCVOMUMD-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.33 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|