C15H26O6P2 — CID 135829326
5-[bis(diethoxyphosphoryl)methylidene]cyclohexa-1,3-diene (PubChem CID 135829326) has the molecular formula C15H26O6P2 and a molecular weight of 364.32 g/mol. Its IUPAC name is 5-[bis(diethoxyphosphoryl)methylidene]cyclohexa-1,3-diene.
| Compound Name | 5-[bis(diethoxyphosphoryl)methylidene]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 135829326 |
| Molecular Formula | C15H26O6P2 |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 5-[bis(diethoxyphosphoryl)methylidene]cyclohexa-1,3-diene |
| SMILES | CCOP(=O)(OCC)C(=C1C=CC=CC1)P(=O)(OCC)OCC |
| InChI | InChI=1S/C15H26O6P2/c1-5-18-22(16,19-6-2)15(14-12-10-9-11-13-14)23(17,20-7-3)21-8-4/h9-12H,5-8,13H2,1-4H3 |
| InChIKey | HBDHZNPJUQLONW-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|