C11H20O6P2 — CID 15496483
1,2-bis(dimethoxyphosphoryl)-4-methylcyclohexa-1,4-diene (PubChem CID 15496483) has the molecular formula C11H20O6P2 and a molecular weight of 310.22 g/mol. Its IUPAC name is 1,2-bis(dimethoxyphosphoryl)-4-methylcyclohexa-1,4-diene.
| Compound Name | 1,2-bis(dimethoxyphosphoryl)-4-methylcyclohexa-1,4-diene |
|---|---|
| PubChem CID | 15496483 |
| Molecular Formula | C11H20O6P2 |
| Molecular Weight | 310.22 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 1,2-bis(dimethoxyphosphoryl)-4-methylcyclohexa-1,4-diene |
| SMILES | COP(=O)(OC)C1=C(P(=O)(OC)OC)CC(C)=CC1 |
| InChI | InChI=1S/C11H20O6P2/c1-9-6-7-10(18(12,14-2)15-3)11(8-9)19(13,16-4)17-5/h6H,7-8H2,1-5H3 |
| InChIKey | DBFPGKQJDYGWJT-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.22 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|