C12H22O6P2 — CID 15496481
1,2-bis(dimethoxyphosphoryl)-4,5-dimethylcyclohexa-1,4-diene (PubChem CID 15496481) has the molecular formula C12H22O6P2 and a molecular weight of 324.25 g/mol. Its IUPAC name is 1,2-bis(dimethoxyphosphoryl)-4,5-dimethylcyclohexa-1,4-diene.
| Compound Name | 1,2-bis(dimethoxyphosphoryl)-4,5-dimethylcyclohexa-1,4-diene |
|---|---|
| PubChem CID | 15496481 |
| Molecular Formula | C12H22O6P2 |
| Molecular Weight | 324.25 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 1,2-bis(dimethoxyphosphoryl)-4,5-dimethylcyclohexa-1,4-diene |
| SMILES | COP(=O)(OC)C1=C(P(=O)(OC)OC)CC(C)=C(C)C1 |
| InChI | InChI=1S/C12H22O6P2/c1-9-7-11(19(13,15-3)16-4)12(8-10(9)2)20(14,17-5)18-6/h7-8H2,1-6H3 |
| InChIKey | AIYFUQHWAVEABH-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.25 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|