C15H30O6P2 — CID 91194045
9,9-bis(dimethoxyphosphoryl)-2,6-dimethylnona-2,6-diene (PubChem CID 91194045) has the molecular formula C15H30O6P2 and a molecular weight of 368.35 g/mol. Its IUPAC name is 9,9-bis(dimethoxyphosphoryl)-2,6-dimethylnona-2,6-diene.
| Compound Name | 9,9-bis(dimethoxyphosphoryl)-2,6-dimethylnona-2,6-diene |
|---|---|
| PubChem CID | 91194045 |
| Molecular Formula | C15H30O6P2 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 9,9-bis(dimethoxyphosphoryl)-2,6-dimethylnona-2,6-diene |
| SMILES | COP(=O)(OC)C(CC=C(C)CCC=C(C)C)P(=O)(OC)OC |
| InChI | InChI=1S/C15H30O6P2/c1-13(2)9-8-10-14(3)11-12-15(22(16,18-4)19-5)23(17,20-6)21-7/h9,11,15H,8,10,12H2,1-7H3 |
| InChIKey | BGYAGCPXRWLCLD-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|