C10H17O4P — CID 134874733
2-dimethoxyphosphoryl-6-methylhepta-1,5-dien-1-one (PubChem CID 134874733) has the molecular formula C10H17O4P and a molecular weight of 232.22 g/mol. Its IUPAC name is 2-dimethoxyphosphoryl-6-methylhepta-1,5-dien-1-one.
| Compound Name | 2-dimethoxyphosphoryl-6-methylhepta-1,5-dien-1-one |
|---|---|
| PubChem CID | 134874733 |
| Molecular Formula | C10H17O4P |
| Molecular Weight | 232.22 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 2-dimethoxyphosphoryl-6-methylhepta-1,5-dien-1-one |
| SMILES | COP(=O)(OC)C(=C=O)CCC=C(C)C |
| InChI | InChI=1S/C10H17O4P/c1-9(2)6-5-7-10(8-11)15(12,13-3)14-4/h6H,5,7H2,1-4H3 |
| InChIKey | BIANGSXVNQGARQ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.22 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|