C20H38O5P2 — CID 14167111
(6E,10E)-13-[dimethoxyphosphorylmethyl(methoxy)phosphoryl]-2,6,10-trimethyltrideca-2,6,10-triene (PubChem CID 14167111) has the molecular formula C20H38O5P2 and a molecular weight of 420.47 g/mol. Its IUPAC name is (6E,10E)-13-[dimethoxyphosphorylmethyl(methoxy)phosphoryl]-2,6,10-trimethyltrideca-2,6,10-triene.
| Compound Name | (6E,10E)-13-[dimethoxyphosphorylmethyl(methoxy)phosphoryl]-2,6,10-trimethyltrideca-2,6,10-triene |
|---|---|
| PubChem CID | 14167111 |
| Molecular Formula | C20H38O5P2 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | (6E,10E)-13-[dimethoxyphosphorylmethyl(methoxy)phosphoryl]-2,6,10-trimethyltrideca-2,6,10-triene |
| SMILES | COP(=O)(CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)CP(=O)(OC)OC |
| InChI | InChI=1S/C20H38O5P2/c1-18(2)11-8-12-19(3)13-9-14-20(4)15-10-16-26(21,23-5)17-27(22,24-6)25-7/h11,13,15H,8-10,12,14,16-17H2,1-7H3/b19-13+,20-15+ |
| InChIKey | KPYXYKGSTQHJKY-YLYRKCBPSA-N |
| XLogP | 7.16 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|