C14H26O6P2 — CID 141358986
(8-diethoxyphosphoryl-8-methylnona-2,4,6-trienyl)phosphonic acid (PubChem CID 141358986) has the molecular formula C14H26O6P2 and a molecular weight of 352.30 g/mol. Its IUPAC name is (8-diethoxyphosphoryl-8-methylnona-2,4,6-trienyl)phosphonic acid.
| Compound Name | (8-diethoxyphosphoryl-8-methylnona-2,4,6-trienyl)phosphonic acid |
|---|---|
| PubChem CID | 141358986 |
| Molecular Formula | C14H26O6P2 |
| Molecular Weight | 352.30 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | (8-diethoxyphosphoryl-8-methylnona-2,4,6-trienyl)phosphonic acid |
| SMILES | CCOP(=O)(OCC)C(C)(C)C=CC=CC=CCP(=O)(O)O |
| InChI | InChI=1S/C14H26O6P2/c1-5-19-22(18,20-6-2)14(3,4)12-10-8-7-9-11-13-21(15,16)17/h7-12H,5-6,13H2,1-4H3,(H2,15,16,17) |
| InChIKey | JOWZRNDBWKXMAE-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.30 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|