C23H17NO4S2 — CID 10113842
(E)-3-(2-naphthalen-2-yloxyphenyl)-N-thiophen-2-ylsulfonylprop-2-enamide (PubChem CID 10113842) has the molecular formula C23H17NO4S2 and a molecular weight of 435.53 g/mol. Its IUPAC name is (E)-3-(2-naphthalen-2-yloxyphenyl)-N-thiophen-2-ylsulfonylprop-2-enamide.
| Compound Name | (E)-3-(2-naphthalen-2-yloxyphenyl)-N-thiophen-2-ylsulfonylprop-2-enamide |
|---|---|
| PubChem CID | 10113842 |
| Molecular Formula | C23H17NO4S2 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.06 |
| IUPAC Name | (E)-3-(2-naphthalen-2-yloxyphenyl)-N-thiophen-2-ylsulfonylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1Oc1ccc2ccccc2c1)NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C23H17NO4S2/c25-22(24-30(26,27)23-10-5-15-29-23)14-12-18-7-3-4-9-21(18)28-20-13-11-17-6-1-2-8-19(17)16-20/h1-16H,(H,24,25)/b14-12+ |
| InChIKey | RGDFCFNBLXTBAF-WYMLVPIESA-N |
| XLogP | 5.21 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|