C15H15BrF3NO3 — CID 101139272
ethyl (1R,2R,10bR)-2-[bromo(difluoro)methyl]-2-fluoro-1,5,6,10b-tetrahydro-[1,2]oxazolo[3,2-a]isoquinoline-1-carboxylate (PubChem CID 101139272) has the molecular formula C15H15BrF3NO3 and a molecular weight of 394.19 g/mol. Its IUPAC name is ethyl (1R,2R,10bR)-2-[bromo(difluoro)methyl]-2-fluoro-1,5,6,10b-tetrahydro-[1,2]oxazolo[3,2-a]isoquinoline-1-carboxylate.
| Compound Name | ethyl (1R,2R,10bR)-2-[bromo(difluoro)methyl]-2-fluoro-1,5,6,10b-tetrahydro-[1,2]oxazolo[3,2-a]isoquinoline-1-carboxylate |
|---|---|
| PubChem CID | 101139272 |
| Molecular Formula | C15H15BrF3NO3 |
| Molecular Weight | 394.19 g/mol |
| Exact Mass | 393.02 |
| IUPAC Name | ethyl (1R,2R,10bR)-2-[bromo(difluoro)methyl]-2-fluoro-1,5,6,10b-tetrahydro-[1,2]oxazolo[3,2-a]isoquinoline-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@@H]2c3ccccc3CCN2O[C@]1(F)C(F)(F)Br |
| InChI | InChI=1S/C15H15BrF3NO3/c1-2-22-13(21)11-12-10-6-4-3-5-9(10)7-8-20(12)23-14(11,17)15(16,18)19/h3-6,11-12H,2,7-8H2,1H3/t11-,12+,14+/m1/s1 |
| InChIKey | ICLNTVNIZVWLHG-DYEKYZERSA-N |
| XLogP | 3.36 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.19 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|