C10H16ClFO — CID 101139578
cis-(2S,5S)-5-(2-chloropropan-2-yl)-2-fluoro-2-methylcyclohexan-1-one (PubChem CID 101139578) has the molecular formula C10H16ClFO and a molecular weight of 206.69 g/mol. Its IUPAC name is cis-(2S,5S)-5-(2-chloropropan-2-yl)-2-fluoro-2-methylcyclohexan-1-one.
| Compound Name | cis-(2S,5S)-5-(2-chloropropan-2-yl)-2-fluoro-2-methylcyclohexan-1-one |
|---|---|
| PubChem CID | 101139578 |
| Molecular Formula | C10H16ClFO |
| Molecular Weight | 206.69 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | cis-(2S,5S)-5-(2-chloropropan-2-yl)-2-fluoro-2-methylcyclohexan-1-one |
| SMILES | CC(C)(Cl)[C@H]1CC[C@](C)(F)C(=O)C1 |
| InChI | InChI=1S/C10H16ClFO/c1-9(2,11)7-4-5-10(3,12)8(13)6-7/h7H,4-6H2,1-3H3/t7-,10-/m0/s1 |
| InChIKey | FKHSXVYUWNNPDG-XVKPBYJWSA-N |
| XLogP | 3.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.69 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|