C28H40O4 — CID 101142110
2-[[(1R,4aS,4bR,10aS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,7,8,8a,9,10,10a-dodecahydrophenanthren-1-yl]methoxycarbonyl]benzoic acid (PubChem CID 101142110) has the molecular formula C28H40O4 and a molecular weight of 440.62 g/mol. Its IUPAC name is 2-[[(1R,4aS,4bR,10aS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,7,8,8a,9,10,10a-dodecahydrophenanthren-1-yl]methoxycarbonyl]benzoic acid.
| Compound Name | 2-[[(1R,4aS,4bR,10aS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,7,8,8a,9,10,10a-dodecahydrophenanthren-1-yl]methoxycarbonyl]benzoic acid |
|---|---|
| PubChem CID | 101142110 |
| Molecular Formula | C28H40O4 |
| Molecular Weight | 440.62 g/mol |
| Exact Mass | 440.29 |
| IUPAC Name | 2-[[(1R,4aS,4bR,10aS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,7,8,8a,9,10,10a-dodecahydrophenanthren-1-yl]methoxycarbonyl]benzoic acid |
| SMILES | CC(C)C1CC[C@@H]2C(CC[C@@H]3[C@](C)(COC(=O)c4ccccc4C(=O)O)CCC[C@@]23C)C1 |
| InChI | InChI=1S/C28H40O4/c1-18(2)19-10-12-23-20(16-19)11-13-24-27(3,14-7-15-28(23,24)4)17-32-26(31)22-9-6-5-8-21(22)25(29)30/h5-6,8-9,18-20,23-24H,7,10-17H2,1-4H3,(H,29,30)/t19?,20?,23-,24-,27+,28+/m1/s1 |
| InChIKey | CSBQZRQCOMPKFB-WPUCYWQQSA-N |
| XLogP | 6.84 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.62 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |