C27H48O — CID 148692172
1-[(1R,4aS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,7,8,8a,9,10,10a-dodecahydrophenanthren-1-yl]octan-3-one (PubChem CID 148692172) has the molecular formula C27H48O and a molecular weight of 388.68 g/mol. Its IUPAC name is 1-[(1R,4aS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,7,8,8a,9,10,10a-dodecahydrophenanthren-1-yl]octan-3-one.
| Compound Name | 1-[(1R,4aS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,7,8,8a,9,10,10a-dodecahydrophenanthren-1-yl]octan-3-one |
|---|---|
| PubChem CID | 148692172 |
| Molecular Formula | C27H48O |
| Molecular Weight | 388.68 g/mol |
| Exact Mass | 388.37 |
| IUPAC Name | 1-[(1R,4aS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,7,8,8a,9,10,10a-dodecahydrophenanthren-1-yl]octan-3-one |
| SMILES | CCCCCC(=O)CC[C@@]1(C)CCC[C@@]2(C)C3CCC(C(C)C)CC3CCC12 |
| InChI | InChI=1S/C27H48O/c1-6-7-8-10-23(28)15-18-26(4)16-9-17-27(5)24-13-11-21(20(2)3)19-22(24)12-14-25(26)27/h20-22,24-25H,6-19H2,1-5H3/t21?,22?,24?,25?,26-,27+/m1/s1 |
| InChIKey | NTRVZZOQDPFAFE-QQWJRRQHSA-N |
| XLogP | 8.21 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.68 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|