C46H52N2O4 — CID 101142990
2-[[(1S,2S)-1,2-bis(3,5-dimethylphenyl)-2-[[3-oxo-2-(2,4,6-trimethylbenzoyl)butylidene]amino]ethyl]iminomethyl]-1-(2,4,6-trimethylphenyl)butane-1,3-dione (PubChem CID 101142990) has the molecular formula C46H52N2O4 and a molecular weight of 696.93 g/mol. Its IUPAC name is 2-[[(1S,2S)-1,2-bis(3,5-dimethylphenyl)-2-[[3-oxo-2-(2,4,6-trimethylbenzoyl)butylidene]amino]ethyl]iminomethyl]-1-(2,4,6-trimethylphenyl)butane-1,3-dione.
| Compound Name | 2-[[(1S,2S)-1,2-bis(3,5-dimethylphenyl)-2-[[3-oxo-2-(2,4,6-trimethylbenzoyl)butylidene]amino]ethyl]iminomethyl]-1-(2,4,6-trimethylphenyl)butane-1,3-dione |
|---|---|
| PubChem CID | 101142990 |
| Molecular Formula | C46H52N2O4 |
| Molecular Weight | 696.93 g/mol |
| Exact Mass | 696.39 |
| IUPAC Name | 2-[[(1S,2S)-1,2-bis(3,5-dimethylphenyl)-2-[[3-oxo-2-(2,4,6-trimethylbenzoyl)butylidene]amino]ethyl]iminomethyl]-1-(2,4,6-trimethylphenyl)butane-1,3-dione |
| SMILES | CC(=O)C(/C=N/[C@@H](c1cc(C)cc(C)c1)[C@@H](/N=C/C(C(C)=O)C(=O)c1c(C)cc(C)cc1C)c1cc(C)cc(C)c1)C(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C46H52N2O4/c1-25-13-26(2)20-37(19-25)43(47-23-39(35(11)49)45(51)41-31(7)15-29(5)16-32(41)8)44(38-21-27(3)14-28(4)22-38)48-24-40(36(12)50)46(52)42-33(9)17-30(6)18-34(42)10/h13-24,39-40,43-44H,1-12H3/b47-23+,48-24+/t39?,40?,43-,44-/m0/s1 |
| InChIKey | WOVSTLJBJHJWIU-KUCPBZPMSA-N |
| XLogP | 9.87 |
| TPSA | 93.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.93 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|