C23H44O4Si2 — CID 101143423
[(2R,3R,6S)-3-triethylsilyloxy-2-(2-triethylsilylprop-2-enyl)-3,6-dihydro-2H-pyran-6-yl]methyl acetate (PubChem CID 101143423) has the molecular formula C23H44O4Si2 and a molecular weight of 440.77 g/mol. Its IUPAC name is [(2R,3R,6S)-3-triethylsilyloxy-2-(2-triethylsilylprop-2-enyl)-3,6-dihydro-2H-pyran-6-yl]methyl acetate.
| Compound Name | [(2R,3R,6S)-3-triethylsilyloxy-2-(2-triethylsilylprop-2-enyl)-3,6-dihydro-2H-pyran-6-yl]methyl acetate |
|---|---|
| PubChem CID | 101143423 |
| Molecular Formula | C23H44O4Si2 |
| Molecular Weight | 440.77 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | [(2R,3R,6S)-3-triethylsilyloxy-2-(2-triethylsilylprop-2-enyl)-3,6-dihydro-2H-pyran-6-yl]methyl acetate |
| SMILES | C=C(C[C@H]1O[C@H](COC(C)=O)C=C[C@H]1O[Si](CC)(CC)CC)[Si](CC)(CC)CC |
| InChI | InChI=1S/C23H44O4Si2/c1-9-28(10-2,11-3)19(7)17-23-22(27-29(12-4,13-5)14-6)16-15-21(26-23)18-25-20(8)24/h15-16,21-23H,7,9-14,17-18H2,1-6,8H3/t21-,22+,23+/m0/s1 |
| InChIKey | CPHHQQHHWZZBJR-YTFSRNRJSA-N |
| XLogP | 6.26 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.77 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|