C15H30O4Si2 — CID 91998784
[(2E,4R,5S)-4,5-bis(trimethylsilyloxy)hepta-2,6-dienyl] acetate (PubChem CID 91998784) has the molecular formula C15H30O4Si2 and a molecular weight of 330.57 g/mol. Its IUPAC name is [(2E,4R,5S)-4,5-bis(trimethylsilyloxy)hepta-2,6-dienyl] acetate.
| Compound Name | [(2E,4R,5S)-4,5-bis(trimethylsilyloxy)hepta-2,6-dienyl] acetate |
|---|---|
| PubChem CID | 91998784 |
| Molecular Formula | C15H30O4Si2 |
| Molecular Weight | 330.57 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | [(2E,4R,5S)-4,5-bis(trimethylsilyloxy)hepta-2,6-dienyl] acetate |
| SMILES | C=C[C@H](O[Si](C)(C)C)[C@@H](/C=C/COC(C)=O)O[Si](C)(C)C |
| InChI | InChI=1S/C15H30O4Si2/c1-9-14(18-20(3,4)5)15(19-21(6,7)8)11-10-12-17-13(2)16/h9-11,14-15H,1,12H2,2-8H3/b11-10+/t14-,15+/m0/s1 |
| InChIKey | JOKMNHRJBJHKCI-KZGTWKPJSA-N |
| XLogP | 3.73 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.57 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|