C25H29ClO5 — CID 10114442
(2R)-7-[3-(2-chloro-4-cyclopentylphenoxy)propoxy]-2-methyl-3,4-dihydrochromene-2-carboxylic acid (PubChem CID 10114442) has the molecular formula C25H29ClO5 and a molecular weight of 444.96 g/mol. Its IUPAC name is (2R)-7-[3-(2-chloro-4-cyclopentylphenoxy)propoxy]-2-methyl-3,4-dihydrochromene-2-carboxylic acid.
| Compound Name | (2R)-7-[3-(2-chloro-4-cyclopentylphenoxy)propoxy]-2-methyl-3,4-dihydrochromene-2-carboxylic acid |
|---|---|
| PubChem CID | 10114442 |
| Molecular Formula | C25H29ClO5 |
| Molecular Weight | 444.96 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | (2R)-7-[3-(2-chloro-4-cyclopentylphenoxy)propoxy]-2-methyl-3,4-dihydrochromene-2-carboxylic acid |
| SMILES | C[C@]1(C(=O)O)CCc2ccc(OCCCOc3ccc(C4CCCC4)cc3Cl)cc2O1 |
| InChI | InChI=1S/C25H29ClO5/c1-25(24(27)28)12-11-18-7-9-20(16-23(18)31-25)29-13-4-14-30-22-10-8-19(15-21(22)26)17-5-2-3-6-17/h7-10,15-17H,2-6,11-14H2,1H3,(H,27,28)/t25-/m1/s1 |
| InChIKey | OOZNMURDAKWFQS-RUZDIDTESA-N |
| XLogP | 6.01 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.96 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|