C21H20ClF3O6 — CID 11385663
6-[3-[2-chloro-4-(trifluoromethoxy)phenoxy]propoxy]-2-ethyl-3H-1-benzofuran-2-carboxylic acid (PubChem CID 11385663) has the molecular formula C21H20ClF3O6 and a molecular weight of 460.83 g/mol. Its IUPAC name is 6-[3-[2-chloro-4-(trifluoromethoxy)phenoxy]propoxy]-2-ethyl-3H-1-benzofuran-2-carboxylic acid.
| Compound Name | 6-[3-[2-chloro-4-(trifluoromethoxy)phenoxy]propoxy]-2-ethyl-3H-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 11385663 |
| Molecular Formula | C21H20ClF3O6 |
| Molecular Weight | 460.83 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | 6-[3-[2-chloro-4-(trifluoromethoxy)phenoxy]propoxy]-2-ethyl-3H-1-benzofuran-2-carboxylic acid |
| SMILES | CCC1(C(=O)O)Cc2ccc(OCCCOc3ccc(OC(F)(F)F)cc3Cl)cc2O1 |
| InChI | InChI=1S/C21H20ClF3O6/c1-2-20(19(26)27)12-13-4-5-14(11-18(13)31-20)28-8-3-9-29-17-7-6-15(10-16(17)22)30-21(23,24)25/h4-7,10-11H,2-3,8-9,12H2,1H3,(H,26,27) |
| InChIKey | BLLKMHPEGRBPKA-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.83 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|