C26H25ClO6 — CID 10162210
7-[3-(2-chloro-4-phenoxyphenoxy)propoxy]-2-methyl-3,4-dihydrochromene-2-carboxylic acid (PubChem CID 10162210) has the molecular formula C26H25ClO6 and a molecular weight of 468.93 g/mol. Its IUPAC name is 7-[3-(2-chloro-4-phenoxyphenoxy)propoxy]-2-methyl-3,4-dihydrochromene-2-carboxylic acid.
| Compound Name | 7-[3-(2-chloro-4-phenoxyphenoxy)propoxy]-2-methyl-3,4-dihydrochromene-2-carboxylic acid |
|---|---|
| PubChem CID | 10162210 |
| Molecular Formula | C26H25ClO6 |
| Molecular Weight | 468.93 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | 7-[3-(2-chloro-4-phenoxyphenoxy)propoxy]-2-methyl-3,4-dihydrochromene-2-carboxylic acid |
| SMILES | CC1(C(=O)O)CCc2ccc(OCCCOc3ccc(Oc4ccccc4)cc3Cl)cc2O1 |
| InChI | InChI=1S/C26H25ClO6/c1-26(25(28)29)13-12-18-8-9-20(17-24(18)33-26)30-14-5-15-31-23-11-10-21(16-22(23)27)32-19-6-3-2-4-7-19/h2-4,6-11,16-17H,5,12-15H2,1H3,(H,28,29) |
| InChIKey | LNHVXGYUBBGCLW-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.93 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|