C18H21NO4 — CID 101144692
(2R)-1-[(3aS,7aS)-2-oxo-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-3-yl]-2-methyl-4-phenylbutane-1,3-dione (PubChem CID 101144692) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is (2R)-1-[(3aS,7aS)-2-oxo-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-3-yl]-2-methyl-4-phenylbutane-1,3-dione.
| Compound Name | (2R)-1-[(3aS,7aS)-2-oxo-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-3-yl]-2-methyl-4-phenylbutane-1,3-dione |
|---|---|
| PubChem CID | 101144692 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | (2R)-1-[(3aS,7aS)-2-oxo-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-3-yl]-2-methyl-4-phenylbutane-1,3-dione |
| SMILES | C[C@H](C(=O)Cc1ccccc1)C(=O)N1C(=O)O[C@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C18H21NO4/c1-12(15(20)11-13-7-3-2-4-8-13)17(21)19-14-9-5-6-10-16(14)23-18(19)22/h2-4,7-8,12,14,16H,5-6,9-11H2,1H3/t12-,14+,16+/m1/s1 |
| InChIKey | MIGQKQWZAYWQDG-INWMFGNUSA-N |
| XLogP | 2.72 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|