C14H17NO3S — CID 134865527
(3aS)-3-benzylsulfinyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-one (PubChem CID 134865527) has the molecular formula C14H17NO3S and a molecular weight of 279.36 g/mol. Its IUPAC name is (3aS)-3-benzylsulfinyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-one.
| Compound Name | (3aS)-3-benzylsulfinyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 134865527 |
| Molecular Formula | C14H17NO3S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | (3aS)-3-benzylsulfinyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-one |
| SMILES | O=C1OC2CCCC[C@@H]2N1S(=O)Cc1ccccc1 |
| InChI | InChI=1S/C14H17NO3S/c16-14-15(12-8-4-5-9-13(12)18-14)19(17)10-11-6-2-1-3-7-11/h1-3,6-7,12-13H,4-5,8-10H2/t12-,13?,19?/m0/s1 |
| InChIKey | BZKKRAORDCHZGI-GLIABKTBSA-N |
| XLogP | 2.61 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |