C8H12FNO2 — CID 154059476
3-(fluoromethyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-one (PubChem CID 154059476) has the molecular formula C8H12FNO2 and a molecular weight of 173.19 g/mol. Its IUPAC name is 3-(fluoromethyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-one.
| Compound Name | 3-(fluoromethyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 154059476 |
| Molecular Formula | C8H12FNO2 |
| Molecular Weight | 173.19 g/mol |
| Exact Mass | 173.09 |
| IUPAC Name | 3-(fluoromethyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-one |
| SMILES | O=C1OC2CCCCC2N1CF |
| InChI | InChI=1S/C8H12FNO2/c9-5-10-6-3-1-2-4-7(6)12-8(10)11/h6-7H,1-5H2 |
| InChIKey | BQKOSGFDFKYLEL-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.19 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|