C15H23N3O5 — CID 140689790
N-(3-nitrocyclohexyl)-2-(2-oxo-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-3-yl)acetamide (PubChem CID 140689790) has the molecular formula C15H23N3O5 and a molecular weight of 325.37 g/mol. Its IUPAC name is N-(3-nitrocyclohexyl)-2-(2-oxo-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-3-yl)acetamide.
| Compound Name | N-(3-nitrocyclohexyl)-2-(2-oxo-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 140689790 |
| Molecular Formula | C15H23N3O5 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | N-(3-nitrocyclohexyl)-2-(2-oxo-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-3-yl)acetamide |
| SMILES | O=C(CN1C(=O)OC2CCCCC21)NC1CCCC([N+](=O)[O-])C1 |
| InChI | InChI=1S/C15H23N3O5/c19-14(16-10-4-3-5-11(8-10)18(21)22)9-17-12-6-1-2-7-13(12)23-15(17)20/h10-13H,1-9H2,(H,16,19) |
| InChIKey | SPZFRTVBMQXXQH-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|