C21H22Br2O7 — CID 101145905
[2-[2,3-dibromo-3-(2,4-dimethoxyphenyl)propanoyl]-3,5-dimethoxyphenyl] acetate (PubChem CID 101145905) has the molecular formula C21H22Br2O7 and a molecular weight of 546.21 g/mol. Its IUPAC name is [2-[2,3-dibromo-3-(2,4-dimethoxyphenyl)propanoyl]-3,5-dimethoxyphenyl] acetate.
| Compound Name | [2-[2,3-dibromo-3-(2,4-dimethoxyphenyl)propanoyl]-3,5-dimethoxyphenyl] acetate |
|---|---|
| PubChem CID | 101145905 |
| Molecular Formula | C21H22Br2O7 |
| Molecular Weight | 546.21 g/mol |
| Exact Mass | 543.97 |
| IUPAC Name | [2-[2,3-dibromo-3-(2,4-dimethoxyphenyl)propanoyl]-3,5-dimethoxyphenyl] acetate |
| SMILES | COc1ccc(C(Br)C(Br)C(=O)c2c(OC)cc(OC)cc2OC(C)=O)c(OC)c1 |
| InChI | InChI=1S/C21H22Br2O7/c1-11(24)30-17-10-13(27-3)9-16(29-5)18(17)21(25)20(23)19(22)14-7-6-12(26-2)8-15(14)28-4/h6-10,19-20H,1-5H3 |
| InChIKey | YFQVCOQOQVHDGM-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.21 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|