C23H25NO2 — CID 101152100
ethyl 1,4-diphenyl-2-propyl-4H-pyridine-3-carboxylate (PubChem CID 101152100) has the molecular formula C23H25NO2 and a molecular weight of 347.46 g/mol. Its IUPAC name is ethyl 1,4-diphenyl-2-propyl-4H-pyridine-3-carboxylate.
| Compound Name | ethyl 1,4-diphenyl-2-propyl-4H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 101152100 |
| Molecular Formula | C23H25NO2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | ethyl 1,4-diphenyl-2-propyl-4H-pyridine-3-carboxylate |
| SMILES | CCCC1=C(C(=O)OCC)C(c2ccccc2)C=CN1c1ccccc1 |
| InChI | InChI=1S/C23H25NO2/c1-3-11-21-22(23(25)26-4-2)20(18-12-7-5-8-13-18)16-17-24(21)19-14-9-6-10-15-19/h5-10,12-17,20H,3-4,11H2,1-2H3 |
| InChIKey | GOORHCUKPJCVRH-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |