C23H25NO15 — CID 101152663
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[[(2S,3S)-2-(5-nitrofuran-2-yl)-4-oxo-2,3-dihydropyran-3-yl]oxy]oxan-2-yl]methyl acetate (PubChem CID 101152663) has the molecular formula C23H25NO15 and a molecular weight of 555.45 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[[(2S,3S)-2-(5-nitrofuran-2-yl)-4-oxo-2,3-dihydropyran-3-yl]oxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[[(2S,3S)-2-(5-nitrofuran-2-yl)-4-oxo-2,3-dihydropyran-3-yl]oxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101152663 |
| Molecular Formula | C23H25NO15 |
| Molecular Weight | 555.45 g/mol |
| Exact Mass | 555.12 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[[(2S,3S)-2-(5-nitrofuran-2-yl)-4-oxo-2,3-dihydropyran-3-yl]oxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](O[C@@H]2C(=O)C=CO[C@@H]2c2ccc([N+](=O)[O-])o2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C23H25NO15/c1-10(25)33-9-16-20(34-11(2)26)21(35-12(3)27)22(36-13(4)28)23(38-16)39-18-14(29)7-8-32-19(18)15-5-6-17(37-15)24(30)31/h5-8,16,18-23H,9H2,1-4H3/t16-,18-,19-,20-,21+,22-,23+/m1/s1 |
| InChIKey | YZGNVTBWLJQUAZ-PQGMIVFZSA-N |
| XLogP | 0.81 |
| TPSA | 206.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.45 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|