C28H36O — CID 101152953
1-(1,3,4,5,6,8,10,11,12,13-decamethyl-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)ethanone (PubChem CID 101152953) has the molecular formula C28H36O and a molecular weight of 388.60 g/mol. Its IUPAC name is 1-(1,3,4,5,6,8,10,11,12,13-decamethyl-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)ethanone.
| Compound Name | 1-(1,3,4,5,6,8,10,11,12,13-decamethyl-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)ethanone |
|---|---|
| PubChem CID | 101152953 |
| Molecular Formula | C28H36O |
| Molecular Weight | 388.60 g/mol |
| Exact Mass | 388.28 |
| IUPAC Name | 1-(1,3,4,5,6,8,10,11,12,13-decamethyl-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)ethanone |
| SMILES | CC(=O)C1CC2(C)c3c(C)c(C)c(C)c(C)c3C1(C)c1c(C)c(C)c(C)c(C)c12 |
| InChI | InChI=1S/C28H36O/c1-13-15(3)19(7)25-23(17(13)5)27(10)12-22(21(9)29)28(25,11)26-20(8)16(4)14(2)18(6)24(26)27/h22H,12H2,1-11H3 |
| InChIKey | NFUBKKVIQOLSPG-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.60 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |