benzyl (3S)-3-diphenylphosphanyl-3-phenylpropanoate

C28H25O2P — CID 101153060

IUPACbenzyl (3S)-3-diphenylphosphanyl-3-phenylpropanoate
SMILESO=C(C[C@@H](c1ccccc1)P(c1ccccc1)c1ccccc1)OCc1ccccc1
InChIInChI=1S/C28H25O2P/c29-28(30-22-23-13-5-1-6-14-23)21-27(24-15-7-2-8-16-24)31(25-17-9-3-10-18-25)26-19-11-4-12-20-26/h1-20,27H,21-22H2/t27-/m0/s1
InChIKeyHEFITFDLJDJMPM-MHZLTWQESA-N
MW424.48 g/mol
LogP5.99
Rot. Bonds8

About benzyl (3S)-3-diphenylphosphanyl-3-phenylpropanoate

benzyl (3S)-3-diphenylphosphanyl-3-phenylpropanoate (PubChem CID 101153060) has the molecular formula C28H25O2P and a molecular weight of 424.48 g/mol. Its IUPAC name is benzyl (3S)-3-diphenylphosphanyl-3-phenylpropanoate.

Molecular Properties

Compound Namebenzyl (3S)-3-diphenylphosphanyl-3-phenylpropanoate
PubChem CID101153060
Molecular FormulaC28H25O2P
Molecular Weight424.48 g/mol
Exact Mass424.16
IUPAC Namebenzyl (3S)-3-diphenylphosphanyl-3-phenylpropanoate
SMILESO=C(C[C@@H](c1ccccc1)P(c1ccccc1)c1ccccc1)OCc1ccccc1
InChIInChI=1S/C28H25O2P/c29-28(30-22-23-13-5-1-6-14-23)21-27(24-15-7-2-8-16-24)31(25-17-9-3-10-18-25)26-19-11-4-12-20-26/h1-20,27H,21-22H2/t27-/m0/s1
InChIKeyHEFITFDLJDJMPM-MHZLTWQESA-N
XLogP5.99
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds8
Heavy Atoms31
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500424.48
LogP ≤ 55.99
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze benzyl (3S)-3-diphenylphosphanyl-3-phenylpropanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl (3S)-3-diphenylphosphanyl-3-phenylpropanoate?
The IUPAC name of benzyl (3S)-3-diphenylphosphanyl-3-phenylpropanoate (CID 101153060) is benzyl (3S)-3-diphenylphosphanyl-3-phenylpropanoate.
What is the SMILES notation for benzyl (3S)-3-diphenylphosphanyl-3-phenylpropanoate?
The canonical SMILES for benzyl (3S)-3-diphenylphosphanyl-3-phenylpropanoate is O=C(C[C@@H](c1ccccc1)P(c1ccccc1)c1ccccc1)OCc1ccccc1.
What is the InChIKey of benzyl (3S)-3-diphenylphosphanyl-3-phenylpropanoate?
The InChIKey is HEFITFDLJDJMPM-MHZLTWQESA-N. The full InChI is InChI=1S/C28H25O2P/c29-28(30-22-23-13-5-1-6-14-23)21-27(24-15-7-2-8-16-24)31(25-17-9-3-10-18-25)26-19-11-4-12-20-26/h1-20,27H,21-22H2/t27-/m0/s1.
What are the key properties of benzyl (3S)-3-diphenylphosphanyl-3-phenylpropanoate?
benzyl (3S)-3-diphenylphosphanyl-3-phenylpropanoate has a molecular weight of 424.48 g/mol, XLogP of 5.99, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl (3S)-3-diphenylphosphanyl-3-phenylpropanoate is sourced from PubChem (CID 101153060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).