C7H8N2O7P2 — CID 101154329
2-[(2,4-dihydroxy-2,4-dioxo-1,2λ5,4λ5-oxadiphosphetan-3-yl)amino]pyridine-3-carboxylic acid (PubChem CID 101154329) has the molecular formula C7H8N2O7P2 and a molecular weight of 294.10 g/mol. Its IUPAC name is 2-[(2,4-dihydroxy-2,4-dioxo-1,2λ5,4λ5-oxadiphosphetan-3-yl)amino]pyridine-3-carboxylic acid.
| Compound Name | 2-[(2,4-dihydroxy-2,4-dioxo-1,2λ5,4λ5-oxadiphosphetan-3-yl)amino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 101154329 |
| Molecular Formula | C7H8N2O7P2 |
| Molecular Weight | 294.10 g/mol |
| Exact Mass | 293.98 |
| IUPAC Name | 2-[(2,4-dihydroxy-2,4-dioxo-1,2λ5,4λ5-oxadiphosphetan-3-yl)amino]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cccnc1NC1P(=O)(O)OP1(=O)O |
| InChI | InChI=1S/C7H8N2O7P2/c10-6(11)4-2-1-3-8-5(4)9-7-17(12,13)16-18(7,14)15/h1-3,7H,(H,8,9)(H,10,11)(H,12,13)(H,14,15) |
| InChIKey | VADVPPSWVIFMNC-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 146.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.10 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|