C20H21NO4S — CID 101154349
[2-methylidene-1-(4-methylphenyl)sulfonylpiperidin-3-yl] benzoate (PubChem CID 101154349) has the molecular formula C20H21NO4S and a molecular weight of 371.46 g/mol. Its IUPAC name is [2-methylidene-1-(4-methylphenyl)sulfonylpiperidin-3-yl] benzoate.
| Compound Name | [2-methylidene-1-(4-methylphenyl)sulfonylpiperidin-3-yl] benzoate |
|---|---|
| PubChem CID | 101154349 |
| Molecular Formula | C20H21NO4S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | [2-methylidene-1-(4-methylphenyl)sulfonylpiperidin-3-yl] benzoate |
| SMILES | C=C1C(OC(=O)c2ccccc2)CCCN1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H21NO4S/c1-15-10-12-18(13-11-15)26(23,24)21-14-6-9-19(16(21)2)25-20(22)17-7-4-3-5-8-17/h3-5,7-8,10-13,19H,2,6,9,14H2,1H3 |
| InChIKey | ZUVMPZHHSZPIIV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |