C16H19NO4S — CID 102041556
2-[1-(4-methylphenyl)sulfonyl-2,3,4,5-tetrahydroazepin-7-yl]prop-2-enoic acid (PubChem CID 102041556) has the molecular formula C16H19NO4S and a molecular weight of 321.40 g/mol. Its IUPAC name is 2-[1-(4-methylphenyl)sulfonyl-2,3,4,5-tetrahydroazepin-7-yl]prop-2-enoic acid.
| Compound Name | 2-[1-(4-methylphenyl)sulfonyl-2,3,4,5-tetrahydroazepin-7-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 102041556 |
| Molecular Formula | C16H19NO4S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 2-[1-(4-methylphenyl)sulfonyl-2,3,4,5-tetrahydroazepin-7-yl]prop-2-enoic acid |
| SMILES | C=C(C(=O)O)C1=CCCCCN1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H19NO4S/c1-12-7-9-14(10-8-12)22(20,21)17-11-5-3-4-6-15(17)13(2)16(18)19/h6-10H,2-5,11H2,1H3,(H,18,19) |
| InChIKey | ZOICYMIUPHOZLT-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|