C20H33NO11 — CID 101155930
(1S,2R,4S)-N-[(2S,3R,4R,5R)-2,3,5,6-tetrahydroxy-4-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 101155930) has the molecular formula C20H33NO11 and a molecular weight of 463.48 g/mol. Its IUPAC name is (1S,2R,4S)-N-[(2S,3R,4R,5R)-2,3,5,6-tetrahydroxy-4-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1S,2R,4S)-N-[(2S,3R,4R,5R)-2,3,5,6-tetrahydroxy-4-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 101155930 |
| Molecular Formula | C20H33NO11 |
| Molecular Weight | 463.48 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | (1S,2R,4S)-N-[(2S,3R,4R,5R)-2,3,5,6-tetrahydroxy-4-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | O=C(NC[C@H](O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O)[C@H](O)CO)[C@@H]1C[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C20H33NO11/c22-6-12(25)18(32-20-17(29)16(28)15(27)13(7-23)31-20)14(26)11(24)5-21-19(30)10-4-8-1-2-9(10)3-8/h1-2,8-18,20,22-29H,3-7H2,(H,21,30)/t8-,9+,10+,11-,12+,13+,14+,15-,16-,17+,18+,20-/m0/s1 |
| InChIKey | YHMLISSRTBOTJV-VXRIHVLYSA-N |
| XLogP | -4.43 |
| TPSA | 209.40 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.48 |
| LogP ≤ 5 | -4.43 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|